C16H23N3O4 — CID 123620758
tert-butyl N-[1-(2-carbamoylanilino)-1-oxobutan-2-yl]carbamate (PubChem CID 123620758) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is tert-butyl N-[1-(2-carbamoylanilino)-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-carbamoylanilino)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123620758 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl N-[1-(2-carbamoylanilino)-1-oxobutan-2-yl]carbamate |
| SMILES | CCC(NC(=O)OC(C)(C)C)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C16H23N3O4/c1-5-11(19-15(22)23-16(2,3)4)14(21)18-12-9-7-6-8-10(12)13(17)20/h6-9,11H,5H2,1-4H3,(H2,17,20)(H,18,21)(H,19,22) |
| InChIKey | OARKUDILKKBWRB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |