C19H28N2O5 — CID 110428354
ethyl 2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]benzoate (PubChem CID 110428354) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is ethyl 2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]benzoate.
| Compound Name | ethyl 2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 110428354 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | ethyl 2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H28N2O5/c1-7-25-17(23)13-10-8-9-11-14(13)20-16(22)15(12(2)3)21-18(24)26-19(4,5)6/h8-12,15H,7H2,1-6H3,(H,20,22)(H,21,24) |
| InChIKey | POZGUABRBNQMOY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |