C15H20BN3O4 — CID 123183364
CID 123183364 (PubChem CID 123183364) has the molecular formula C15H20BN3O4 and a molecular weight of 317.15 g/mol.
| Compound Name | CID 123183364 |
|---|---|
| PubChem CID | 123183364 |
| Molecular Formula | C15H20BN3O4 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | — |
| SMILES | [B]NC(=O)c1ccccc1NC(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20BN3O4/c1-9(17-14(22)23-15(2,3)4)12(20)18-11-8-6-5-7-10(11)13(21)19-16/h5-9H,1-4H3,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | HNUXWAIDCJKMKN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|