C22H26N2O5 — CID 39982679
ethyl 2-[[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetyl]amino]benzoate (PubChem CID 39982679) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl 2-[[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39982679 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | ethyl 2-[[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Cc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-5-28-20(26)17-8-6-7-9-18(17)24-19(25)14-15-10-12-16(13-11-15)23-21(27)29-22(2,3)4/h6-13H,5,14H2,1-4H3,(H,23,27)(H,24,25) |
| InChIKey | AZMUYAVEZSPPCM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |