C25H40O2Si — CID 67825501
9-[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-yl]nonan-1-ol (PubChem CID 67825501) has the molecular formula C25H40O2Si and a molecular weight of 400.68 g/mol. Its IUPAC name is 9-[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-yl]nonan-1-ol.
| Compound Name | 9-[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-yl]nonan-1-ol |
|---|---|
| PubChem CID | 67825501 |
| Molecular Formula | C25H40O2Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 9-[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-yl]nonan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2ccc(CCCCCCCCCO)cc2c1 |
| InChI | InChI=1S/C25H40O2Si/c1-25(2,3)28(4,5)27-24-17-16-22-15-14-21(19-23(22)20-24)13-11-9-7-6-8-10-12-18-26/h14-17,19-20,26H,6-13,18H2,1-5H3 |
| InChIKey | RNGIOUAOKWGTAF-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|