C20H36N2OSi — CID 134875724
N-[(E)-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]hexylideneamino]-N-methylmethanamine (PubChem CID 134875724) has the molecular formula C20H36N2OSi and a molecular weight of 348.61 g/mol. Its IUPAC name is N-[(E)-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]hexylideneamino]-N-methylmethanamine.
| Compound Name | N-[(E)-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]hexylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 134875724 |
| Molecular Formula | C20H36N2OSi |
| Molecular Weight | 348.61 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N-[(E)-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]hexylideneamino]-N-methylmethanamine |
| SMILES | CN(C)/N=C/CCCCCc1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H36N2OSi/c1-20(2,3)24(6,7)23-19-15-13-18(14-16-19)12-10-8-9-11-17-21-22(4)5/h13-17H,8-12H2,1-7H3/b21-17+ |
| InChIKey | KSMLJGCNUBUPBF-HEHNFIMWSA-N |
| XLogP | 5.72 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|