C25H36O2Si — CID 139843596
5-[4-[2-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]phenyl]pentanal (PubChem CID 139843596) has the molecular formula C25H36O2Si and a molecular weight of 396.65 g/mol. Its IUPAC name is 5-[4-[2-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]phenyl]pentanal.
| Compound Name | 5-[4-[2-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]phenyl]pentanal |
|---|---|
| PubChem CID | 139843596 |
| Molecular Formula | C25H36O2Si |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 5-[4-[2-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]phenyl]pentanal |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccccc1CCc1ccc(CCCCC=O)cc1 |
| InChI | InChI=1S/C25H36O2Si/c1-25(2,3)28(4,5)27-24-13-9-8-12-23(24)19-18-22-16-14-21(15-17-22)11-7-6-10-20-26/h8-9,12-17,20H,6-7,10-11,18-19H2,1-5H3 |
| InChIKey | IYEPFNLKJWSFSN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|