C33H52N2O3Si — CID 134923111
tert-butyl 4-[7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(E)-(dimethylhydrazinylidene)methyl]heptyl]benzoate (PubChem CID 134923111) has the molecular formula C33H52N2O3Si and a molecular weight of 552.88 g/mol. Its IUPAC name is tert-butyl 4-[7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(E)-(dimethylhydrazinylidene)methyl]heptyl]benzoate.
| Compound Name | tert-butyl 4-[7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(E)-(dimethylhydrazinylidene)methyl]heptyl]benzoate |
|---|---|
| PubChem CID | 134923111 |
| Molecular Formula | C33H52N2O3Si |
| Molecular Weight | 552.88 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | tert-butyl 4-[7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(E)-(dimethylhydrazinylidene)methyl]heptyl]benzoate |
| SMILES | CN(C)/N=C/C(CCCCCc1ccc(O[Si](C)(C)C(C)(C)C)cc1)Cc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C33H52N2O3Si/c1-32(2,3)37-31(36)29-20-16-27(17-21-29)24-28(25-34-35(7)8)15-13-11-12-14-26-18-22-30(23-19-26)38-39(9,10)33(4,5)6/h16-23,25,28H,11-15,24H2,1-10H3/b34-25+ |
| InChIKey | XYRJRCYKQQBUDP-YQCHCMBFSA-N |
| XLogP | 8.54 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.88 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|