C14H21NO4 — CID 134407020
tert-butyl 4-[(2S)-2-amino-3,3-dihydroxypropyl]benzoate (PubChem CID 134407020) has the molecular formula C14H21NO4 and a molecular weight of 267.33 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-2-amino-3,3-dihydroxypropyl]benzoate.
| Compound Name | tert-butyl 4-[(2S)-2-amino-3,3-dihydroxypropyl]benzoate |
|---|---|
| PubChem CID | 134407020 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl 4-[(2S)-2-amino-3,3-dihydroxypropyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(C[C@H](N)C(O)O)cc1 |
| InChI | InChI=1S/C14H21NO4/c1-14(2,3)19-13(18)10-6-4-9(5-7-10)8-11(15)12(16)17/h4-7,11-12,16-17H,8,15H2,1-3H3/t11-/m0/s1 |
| InChIKey | UGGWORJIYXKVDI-NSHDSACASA-N |
| XLogP | 0.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|