C22H31NO2 — CID 143794489
tert-butyl 4-[4-(2-aminopropyl)phenyl]benzoate;ethane (PubChem CID 143794489) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-aminopropyl)phenyl]benzoate;ethane.
| Compound Name | tert-butyl 4-[4-(2-aminopropyl)phenyl]benzoate;ethane |
|---|---|
| PubChem CID | 143794489 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | tert-butyl 4-[4-(2-aminopropyl)phenyl]benzoate;ethane |
| SMILES | CC.CC(N)Cc1ccc(-c2ccc(C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H25NO2.C2H6/c1-14(21)13-15-5-7-16(8-6-15)17-9-11-18(12-10-17)19(22)23-20(2,3)4;1-2/h5-12,14H,13,21H2,1-4H3;1-2H3 |
| InChIKey | ZYWKAXPQGGEFFD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |