C22H32O3Si — CID 25259067
(1R,10R,13S,15S)-5-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-14-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-2(7),3,5-trien-12-one (PubChem CID 25259067) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (1R,10R,13S,15S)-5-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-14-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-2(7),3,5-trien-12-one.
| Compound Name | (1R,10R,13S,15S)-5-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-14-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-2(7),3,5-trien-12-one |
|---|---|
| PubChem CID | 25259067 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (1R,10R,13S,15S)-5-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-14-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-2(7),3,5-trien-12-one |
| SMILES | CC[C@]12c3ccc(O[Si](C)(C)C(C)(C)C)cc3CC[C@@H]1CC(=O)[C@H]1O[C@H]12 |
| InChI | InChI=1S/C22H32O3Si/c1-7-22-15(13-18(23)19-20(22)24-19)9-8-14-12-16(10-11-17(14)22)25-26(5,6)21(2,3)4/h10-12,15,19-20H,7-9,13H2,1-6H3/t15-,19-,20-,22-/m1/s1 |
| InChIKey | ULGJUGCORHEQMQ-GFACEEGYSA-N |
| XLogP | 5.02 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|