C16H28OSSi — CID 59889233
tert-butyl-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-4-yl)oxy]-dimethylsilane (PubChem CID 59889233) has the molecular formula C16H28OSSi and a molecular weight of 296.55 g/mol. Its IUPAC name is tert-butyl-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-4-yl)oxy]-dimethylsilane.
| Compound Name | tert-butyl-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-4-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 59889233 |
| Molecular Formula | C16H28OSSi |
| Molecular Weight | 296.55 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-4-yl)oxy]-dimethylsilane |
| SMILES | CC1(C)CCc2sccc2C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28OSSi/c1-15(2,3)19(6,7)17-14-12-9-11-18-13(12)8-10-16(14,4)5/h9,11,14H,8,10H2,1-7H3 |
| InChIKey | KKDLCPINJXFUBJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|