C20H34O4SSi — CID 14140296
4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)-1-thiophen-2-ylcyclobut-2-en-1-ol (PubChem CID 14140296) has the molecular formula C20H34O4SSi and a molecular weight of 398.64 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)-1-thiophen-2-ylcyclobut-2-en-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)-1-thiophen-2-ylcyclobut-2-en-1-ol |
|---|---|
| PubChem CID | 14140296 |
| Molecular Formula | C20H34O4SSi |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)-1-thiophen-2-ylcyclobut-2-en-1-ol |
| SMILES | CC(C)OC1=C(OC(C)C)C(O)(c2cccs2)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O4SSi/c1-13(2)22-16-17(23-14(3)4)20(21,15-11-10-12-25-15)18(16)24-26(8,9)19(5,6)7/h10-14,18,21H,1-9H3 |
| InChIKey | WAPFZKAQXIPCAO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|