C16H30O4Si — CID 14140289
4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one (PubChem CID 14140289) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 14140289 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)C(O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H30O4Si/c1-10(2)18-13-12(17)14(15(13)19-11(3)4)20-21(8,9)16(5,6)7/h10-11,14H,1-9H3 |
| InChIKey | YAHHXTDGFKWPNH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|