C26H42O5Si — CID 10837776
(1R,5R,9S,10R,11S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,4-di(propan-2-yloxy)tetracyclo[9.3.0.01,5.06,10]tetradeca-3,6-dien-2-one (PubChem CID 10837776) has the molecular formula C26H42O5Si and a molecular weight of 462.70 g/mol. Its IUPAC name is (1R,5R,9S,10R,11S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,4-di(propan-2-yloxy)tetracyclo[9.3.0.01,5.06,10]tetradeca-3,6-dien-2-one.
| Compound Name | (1R,5R,9S,10R,11S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,4-di(propan-2-yloxy)tetracyclo[9.3.0.01,5.06,10]tetradeca-3,6-dien-2-one |
|---|---|
| PubChem CID | 10837776 |
| Molecular Formula | C26H42O5Si |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | (1R,5R,9S,10R,11S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,4-di(propan-2-yloxy)tetracyclo[9.3.0.01,5.06,10]tetradeca-3,6-dien-2-one |
| SMILES | CC(C)OC1=C(OC(C)C)[C@@]2(O)C3=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3[C@@H]3CCC[C@@]32C1=O |
| InChI | InChI=1S/C26H42O5Si/c1-15(2)29-21-22(27)25-14-10-11-17(25)20-18(26(25,28)23(21)30-16(3)4)12-13-19(20)31-32(8,9)24(5,6)7/h12,15-17,19-20,28H,10-11,13-14H2,1-9H3/t17-,19-,20+,25-,26-/m0/s1 |
| InChIKey | CECSOSIKHNLZTA-SYAHEAJDSA-N |
| XLogP | 5.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|