About 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one
4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one (PubChem CID 132515194) has the molecular formula C11H15F3O4
and a molecular weight of 268.23 g/mol. Its IUPAC name is 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one.
Molecular Properties
| Compound Name | 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one |
| PubChem CID | 132515194 |
| Molecular Formula | C11H15F3O4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)C(O)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C11H15F3O4/c1-5(2)17-7-8(15)10(16,11(12,13)14)9(7)18-6(3)4/h5-6,16H,1-4H3 |
| InChIKey | DMDPGCYWXFANHQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one?
The IUPAC name of 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one (CID 132515194) is 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one.
What is the SMILES notation for 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one?
The canonical SMILES for 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one is CC(C)OC1=C(OC(C)C)C(O)(C(F)(F)F)C1=O.
What is the InChIKey of 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one?
The InChIKey is DMDPGCYWXFANHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3O4/c1-5(2)17-7-8(15)10(16,11(12,13)14)9(7)18-6(3)4/h5-6,16H,1-4H3.
What are the key properties of 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one?
4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one has a molecular weight of 268.23 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-di(propan-2-yloxy)-4-(trifluoromethyl)cyclobut-2-en-1-one is sourced from PubChem (CID 132515194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).