C15H13F5O3 — CID 132937787
4-hydroxy-4-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-3-propan-2-yloxycyclobut-2-en-1-one (PubChem CID 132937787) has the molecular formula C15H13F5O3 and a molecular weight of 336.26 g/mol. Its IUPAC name is 4-hydroxy-4-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-3-propan-2-yloxycyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-4-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-3-propan-2-yloxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 132937787 |
| Molecular Formula | C15H13F5O3 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-hydroxy-4-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-3-propan-2-yloxycyclobut-2-en-1-one |
| SMILES | CC(C)OC1=C(c2ccccc2)C(=O)C1(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F5O3/c1-8(2)23-12-10(9-6-4-3-5-7-9)11(21)13(12,22)14(16,17)15(18,19)20/h3-8,22H,1-2H3 |
| InChIKey | GERFREWHMGXUSY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|