C14H23NO4 — CID 11108396
2-(dimethylamino)-2-methyl-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione (PubChem CID 11108396) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(dimethylamino)-2-methyl-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione.
| Compound Name | 2-(dimethylamino)-2-methyl-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 11108396 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(dimethylamino)-2-methyl-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione |
| SMILES | CC(C)OC1=C(OC(C)C)C(=O)C(C)(N(C)C)C1=O |
| InChI | InChI=1S/C14H23NO4/c1-8(2)18-10-11(19-9(3)4)13(17)14(5,12(10)16)15(6)7/h8-9H,1-7H3 |
| InChIKey | RJFRVNAALLFGIB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|