C20H34OSi — CID 24755647
[(7S,7aS,7bR)-6,6,7b-trimethyl-2,5,7,7a-tetrahydro-1H-cyclobuta[g]inden-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 24755647) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is [(7S,7aS,7bR)-6,6,7b-trimethyl-2,5,7,7a-tetrahydro-1H-cyclobuta[g]inden-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(7S,7aS,7bR)-6,6,7b-trimethyl-2,5,7,7a-tetrahydro-1H-cyclobuta[g]inden-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 24755647 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | [(7S,7aS,7bR)-6,6,7b-trimethyl-2,5,7,7a-tetrahydro-1H-cyclobuta[g]inden-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)CC2=CC=C3CC[C@]3(C)[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34OSi/c1-18(2,3)22(7,8)21-17-16-14(13-19(17,4)5)9-10-15-11-12-20(15,16)6/h9-10,16-17H,11-13H2,1-8H3/t16-,17+,20+/m1/s1 |
| InChIKey | OOCGNJVFCSHKIW-UWVAXJGDSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|