C20H36OSi — CID 53472950
[(1R,3aR,4Z,8Z,9aS)-2,2,5-trimethyl-1,3,3a,6,7,9a-hexahydrocyclopenta[8]annulen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 53472950) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is [(1R,3aR,4Z,8Z,9aS)-2,2,5-trimethyl-1,3,3a,6,7,9a-hexahydrocyclopenta[8]annulen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4Z,8Z,9aS)-2,2,5-trimethyl-1,3,3a,6,7,9a-hexahydrocyclopenta[8]annulen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53472950 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | [(1R,3aR,4Z,8Z,9aS)-2,2,5-trimethyl-1,3,3a,6,7,9a-hexahydrocyclopenta[8]annulen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C/C1=C/[C@H]2CC(C)(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2/C=C\CC1 |
| InChI | InChI=1S/C20H36OSi/c1-15-11-9-10-12-17-16(13-15)14-20(5,6)18(17)21-22(7,8)19(2,3)4/h10,12-13,16-18H,9,11,14H2,1-8H3/b12-10-,15-13-/t16-,17-,18+/m0/s1 |
| InChIKey | LWGJZXPNKBXMHT-VPVXMFJRSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|