C29H38O2Si — CID 11026683
(1R,3aR,8Z,9aR)-1-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-5-one (PubChem CID 11026683) has the molecular formula C29H38O2Si and a molecular weight of 446.71 g/mol. Its IUPAC name is (1R,3aR,8Z,9aR)-1-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-5-one.
| Compound Name | (1R,3aR,8Z,9aR)-1-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-5-one |
|---|---|
| PubChem CID | 11026683 |
| Molecular Formula | C29H38O2Si |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (1R,3aR,8Z,9aR)-1-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-5-one |
| SMILES | CC1(C)C[C@@H]2CC(=O)CC/C=C\[C@@H]2[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H38O2Si/c1-28(2,3)32(24-15-8-6-9-16-24,25-17-10-7-11-18-25)31-27-26-19-13-12-14-23(30)20-22(26)21-29(27,4)5/h6-11,13,15-19,22,26-27H,12,14,20-21H2,1-5H3/b19-13-/t22-,26-,27+/m0/s1 |
| InChIKey | UPNJJBACEJNZNP-CBLCCBKDSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|