C27H54O5Si2 — CID 11049545
3-[(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyloxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 11049545) has the molecular formula C27H54O5Si2 and a molecular weight of 514.90 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyloxolan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyloxolan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11049545 |
| Molecular Formula | C27H54O5Si2 |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | 3-[(2S,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyloxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H]1O[C@@H](CCCOC(=O)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O5Si2/c1-15-17-20-22(31-33(11,12)26(5,6)7)23(32-34(13,14)27(8,9)10)21(30-20)18-16-19-29-24(28)25(2,3)4/h15,20-23H,1,16-19H2,2-14H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | HPIRUAZYTIBOBQ-KAOXLYBCSA-N |
| XLogP | 7.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|