C21H40O5Si — CID 11258100
3-[(2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 11258100) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is 3-[(2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11258100 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 3-[(2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H]1O[C@@H](CCCOC(=O)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C21H40O5Si/c1-10-12-15-17(22)18(26-27(8,9)21(5,6)7)16(25-15)13-11-14-24-19(23)20(2,3)4/h10,15-18,22H,1,11-14H2,2-9H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | GWMQALDOYABHGP-XMTFNYHQSA-N |
| XLogP | 4.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|