C21H40O4Si — CID 138963627
[(2R,4S,5S)-4-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl]oxy-5-prop-2-enyloxolan-2-yl]methanol (PubChem CID 138963627) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is [(2R,4S,5S)-4-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl]oxy-5-prop-2-enyloxolan-2-yl]methanol.
| Compound Name | [(2R,4S,5S)-4-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl]oxy-5-prop-2-enyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 138963627 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | [(2R,4S,5S)-4-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl]oxy-5-prop-2-enyloxolan-2-yl]methanol |
| SMILES | C=CC[C@@H]1O[C@@H](CO)C[C@@H]1O[C@H](CC=C)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-9-12-18(17(11-3)25-26(7,8)21(4,5)6)24-20-14-16(15-22)23-19(20)13-10-2/h9-10,16-20,22H,1-2,11-15H2,3-8H3/t16-,17-,18-,19+,20+/m1/s1 |
| InChIKey | BPAMFAMVWKXVGB-UEDWAMCQSA-N |
| XLogP | 4.84 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|