C19H38O3Si — CID 178184676
(2S,3R,5S)-2-prop-2-enyl-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-3-ol (PubChem CID 178184676) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is (2S,3R,5S)-2-prop-2-enyl-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-3-ol.
| Compound Name | (2S,3R,5S)-2-prop-2-enyl-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-3-ol |
|---|---|
| PubChem CID | 178184676 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (2S,3R,5S)-2-prop-2-enyl-5-[3-tri(propan-2-yl)silyloxypropyl]oxolan-3-ol |
| SMILES | C=CC[C@@H]1O[C@@H](CCCO[Si](C(C)C)(C(C)C)C(C)C)C[C@H]1O |
| InChI | InChI=1S/C19H38O3Si/c1-8-10-19-18(20)13-17(22-19)11-9-12-21-23(14(2)3,15(4)5)16(6)7/h8,14-20H,1,9-13H2,2-7H3/t17-,18+,19-/m0/s1 |
| InChIKey | AXBDLVMSQSWFON-OTWHNJEPSA-N |
| XLogP | 5.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|