C20H40O4Si — CID 134841869
1-[(4S,5S)-5-[(4S)-4-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-ol (PubChem CID 134841869) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is 1-[(4S,5S)-5-[(4S)-4-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-ol.
| Compound Name | 1-[(4S,5S)-5-[(4S)-4-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 134841869 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 1-[(4S,5S)-5-[(4S)-4-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-ol |
| SMILES | C=CCC(O)[C@@H]1OC(C)(C)O[C@H]1CCC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-10-12-16(21)18-17(22-20(6,7)23-18)14-11-13-15(2)24-25(8,9)19(3,4)5/h10,15-18,21H,1,11-14H2,2-9H3/t15-,16?,17-,18-/m0/s1 |
| InChIKey | KKLVWMJHXYTGNO-CLTRGCNDSA-N |
| XLogP | 5.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|