C24H48O4Si — CID 11281810
(2S)-1-[(4S,6R)-2,2-dimethyl-6-[4-tri(propan-2-yl)silyloxybutyl]-1,3-dioxan-4-yl]pent-4-en-2-ol (PubChem CID 11281810) has the molecular formula C24H48O4Si and a molecular weight of 428.73 g/mol. Its IUPAC name is (2S)-1-[(4S,6R)-2,2-dimethyl-6-[4-tri(propan-2-yl)silyloxybutyl]-1,3-dioxan-4-yl]pent-4-en-2-ol.
| Compound Name | (2S)-1-[(4S,6R)-2,2-dimethyl-6-[4-tri(propan-2-yl)silyloxybutyl]-1,3-dioxan-4-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 11281810 |
| Molecular Formula | C24H48O4Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (2S)-1-[(4S,6R)-2,2-dimethyl-6-[4-tri(propan-2-yl)silyloxybutyl]-1,3-dioxan-4-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@H](O)C[C@H]1C[C@@H](CCCCO[Si](C(C)C)(C(C)C)C(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C24H48O4Si/c1-10-13-21(25)16-23-17-22(27-24(8,9)28-23)14-11-12-15-26-29(18(2)3,19(4)5)20(6)7/h10,18-23,25H,1,11-17H2,2-9H3/t21-,22+,23-/m0/s1 |
| InChIKey | VSHGXBJDQVVFJA-ZRBLBEILSA-N |
| XLogP | 6.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|