C22H44O5Si — CID 134841870
tert-butyl-[(2S)-5-[(4S,5S)-5-[(1R)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-yl]oxy-dimethylsilane (PubChem CID 134841870) has the molecular formula C22H44O5Si and a molecular weight of 416.68 g/mol. Its IUPAC name is tert-butyl-[(2S)-5-[(4S,5S)-5-[(1R)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-5-[(4S,5S)-5-[(1R)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134841870 |
| Molecular Formula | C22H44O5Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | tert-butyl-[(2S)-5-[(4S,5S)-5-[(1R)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](OCOC)[C@@H]1OC(C)(C)O[C@H]1CCC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O5Si/c1-11-13-18(24-16-23-8)20-19(25-22(6,7)26-20)15-12-14-17(2)27-28(9,10)21(3,4)5/h11,17-20H,1,12-16H2,2-10H3/t17-,18+,19-,20-/m0/s1 |
| InChIKey | GDIOZVPFXMOLBW-YRPNKDGESA-N |
| XLogP | 5.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|