C18H34O4Si — CID 134931288
[(3aR,4R,6R,6aS)-2,2-dimethyl-6-(2-methylprop-2-enyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134931288) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is [(3aR,4R,6R,6aS)-2,2-dimethyl-6-(2-methylprop-2-enyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4R,6R,6aS)-2,2-dimethyl-6-(2-methylprop-2-enyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134931288 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(3aR,4R,6R,6aS)-2,2-dimethyl-6-(2-methylprop-2-enyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C(C)C[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H34O4Si/c1-12(2)10-13-15-16(22-18(6,7)21-15)14(20-13)11-19-23(8,9)17(3,4)5/h13-16H,1,10-11H2,2-9H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | RPXNYRJJUWXRBX-LVQVYYBASA-N |
| XLogP | 4.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|