C19H36O4Si — CID 164671267
tert-butyl-[(1S)-1-[(2S,5R)-5-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]ethoxy]-dimethylsilane (PubChem CID 164671267) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2S,5R)-5-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(2S,5R)-5-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 164671267 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2S,5R)-5-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]ethoxy]-dimethylsilane |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1[C@H]1CC[C@@H]([C@H](C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H36O4Si/c1-10-14-17(22-19(6,7)21-14)16-12-11-15(20-16)13(2)23-24(8,9)18(3,4)5/h10,13-17H,1,11-12H2,2-9H3/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | AKIQZISQIUKVAH-DMRKSPOLSA-N |
| XLogP | 4.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|