C21H42O5Si — CID 134842068
tert-butyl-[(2S)-5-[(4R,5S)-5-[(1R)-1-(methoxymethoxy)but-3-enyl]-2-methyl-1,3-dioxolan-4-yl]pentan-2-yl]oxy-dimethylsilane (PubChem CID 134842068) has the molecular formula C21H42O5Si and a molecular weight of 402.65 g/mol. Its IUPAC name is tert-butyl-[(2S)-5-[(4R,5S)-5-[(1R)-1-(methoxymethoxy)but-3-enyl]-2-methyl-1,3-dioxolan-4-yl]pentan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-5-[(4R,5S)-5-[(1R)-1-(methoxymethoxy)but-3-enyl]-2-methyl-1,3-dioxolan-4-yl]pentan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134842068 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | tert-butyl-[(2S)-5-[(4R,5S)-5-[(1R)-1-(methoxymethoxy)but-3-enyl]-2-methyl-1,3-dioxolan-4-yl]pentan-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](OCOC)[C@@H]1OC(C)O[C@@H]1CCC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O5Si/c1-10-12-18(23-15-22-7)20-19(24-17(3)25-20)14-11-13-16(2)26-27(8,9)21(4,5)6/h10,16-20H,1,11-15H2,2-9H3/t16-,17?,18+,19+,20-/m0/s1 |
| InChIKey | TUDTVJAKBBISKN-MMWAWKIVSA-N |
| XLogP | 5.26 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|