C18H34O5 — CID 134844306
(6R,8R)-6-methoxy-1-(2-prop-2-enyl-1,3-dioxolan-2-yl)undecane-2,8-diol (PubChem CID 134844306) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is (6R,8R)-6-methoxy-1-(2-prop-2-enyl-1,3-dioxolan-2-yl)undecane-2,8-diol.
| Compound Name | (6R,8R)-6-methoxy-1-(2-prop-2-enyl-1,3-dioxolan-2-yl)undecane-2,8-diol |
|---|---|
| PubChem CID | 134844306 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (6R,8R)-6-methoxy-1-(2-prop-2-enyl-1,3-dioxolan-2-yl)undecane-2,8-diol |
| SMILES | C=CCC1(CC(O)CCC[C@H](C[C@H](O)CCC)OC)OCCO1 |
| InChI | InChI=1S/C18H34O5/c1-4-7-15(19)13-17(21-3)9-6-8-16(20)14-18(10-5-2)22-11-12-23-18/h5,15-17,19-20H,2,4,6-14H2,1,3H3/t15-,16?,17-/m1/s1 |
| InChIKey | SVOOCUZOUIDOOU-PWZMFNOBSA-N |
| XLogP | 2.79 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|