C20H34O4 — CID 11988731
(4S,5S)-4-but-3-enyl-5-[2-[(4S,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 11988731) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (4S,5S)-4-but-3-enyl-5-[2-[(4S,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-but-3-enyl-5-[2-[(4S,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11988731 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (4S,5S)-4-but-3-enyl-5-[2-[(4S,5S)-5-but-3-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CCC[C@@H]1OC(C)(C)O[C@H]1CC[C@@H]1OC(C)(C)O[C@H]1CCC=C |
| InChI | InChI=1S/C20H34O4/c1-7-9-11-15-17(23-19(3,4)21-15)13-14-18-16(12-10-8-2)22-20(5,6)24-18/h7-8,15-18H,1-2,9-14H2,3-6H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | JBNQMDQGYBGJKE-XSLAGTTESA-N |
| XLogP | 4.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|