C31H62O6Si — CID 134971558
(2R,3S,4S,5S,7R,9R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,9,10-trimethyl-3-propan-2-yloxy-7-tri(propan-2-yl)silyloxyundec-10-ene-4,5-diol (PubChem CID 134971558) has the molecular formula C31H62O6Si and a molecular weight of 558.92 g/mol. Its IUPAC name is (2R,3S,4S,5S,7R,9R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,9,10-trimethyl-3-propan-2-yloxy-7-tri(propan-2-yl)silyloxyundec-10-ene-4,5-diol.
| Compound Name | (2R,3S,4S,5S,7R,9R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,9,10-trimethyl-3-propan-2-yloxy-7-tri(propan-2-yl)silyloxyundec-10-ene-4,5-diol |
|---|---|
| PubChem CID | 134971558 |
| Molecular Formula | C31H62O6Si |
| Molecular Weight | 558.92 g/mol |
| Exact Mass | 558.43 |
| IUPAC Name | (2R,3S,4S,5S,7R,9R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,9,10-trimethyl-3-propan-2-yloxy-7-tri(propan-2-yl)silyloxyundec-10-ene-4,5-diol |
| SMILES | C=C(C)[C@H](C)C[C@H](C[C@H](O)[C@H](O)[C@@H](OC(C)C)[C@H](C)C[C@@H]1COC(C)(C)O1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H62O6Si/c1-19(2)24(11)15-26(37-38(21(5)6,22(7)8)23(9)10)17-28(32)29(33)30(35-20(3)4)25(12)16-27-18-34-31(13,14)36-27/h20-30,32-33H,1,15-18H2,2-14H3/t24-,25-,26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | UOVQVTMWNKUEFH-NZSNKUITSA-N |
| XLogP | 7.23 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.92 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|