C25H48O7Si — CID 135054268
(2R,3S,4R,5R,6R)-2-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(methoxymethoxy)-3-methyl-1,7-dioxaspiro[5.5]undec-8-en-5-ol (PubChem CID 135054268) has the molecular formula C25H48O7Si and a molecular weight of 488.74 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(methoxymethoxy)-3-methyl-1,7-dioxaspiro[5.5]undec-8-en-5-ol.
| Compound Name | (2R,3S,4R,5R,6R)-2-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(methoxymethoxy)-3-methyl-1,7-dioxaspiro[5.5]undec-8-en-5-ol |
|---|---|
| PubChem CID | 135054268 |
| Molecular Formula | C25H48O7Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(methoxymethoxy)-3-methyl-1,7-dioxaspiro[5.5]undec-8-en-5-ol |
| SMILES | COCO[C@@H]1[C@@H](C)[C@@H]([C@@H](C)[C@@H](OC)[C@H](C)CO[Si](C)(C)C(C)(C)C)O[C@]2(CCC=CO2)[C@@H]1O |
| InChI | InChI=1S/C25H48O7Si/c1-17(15-31-33(9,10)24(4,5)6)20(28-8)18(2)21-19(3)22(29-16-27-7)23(26)25(32-21)13-11-12-14-30-25/h12,14,17-23,26H,11,13,15-16H2,1-10H3/t17-,18+,19+,20+,21-,22-,23-,25-/m1/s1 |
| InChIKey | FNTCARMMRFSILJ-FSNISEPASA-N |
| XLogP | 4.70 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|