C19H36O5Si — CID 11268781
(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-ethenyloxolan-3-ol (PubChem CID 11268781) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-ethenyloxolan-3-ol.
| Compound Name | (2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-ethenyloxolan-3-ol |
|---|---|
| PubChem CID | 11268781 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-ethenyloxolan-3-ol |
| SMILES | C=C[C@H]1O[C@H]([C@@]2(OC)OCC[C@@H](C)[C@H]2O[Si](C)(C)C(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C19H36O5Si/c1-9-15-14(20)12-16(23-15)19(21-6)17(13(2)10-11-22-19)24-25(7,8)18(3,4)5/h9,13-17,20H,1,10-12H2,2-8H3/t13-,14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | FKZTWFPBUWCJOT-FEFVAOQBSA-N |
| XLogP | 3.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|