C34H68O6Si2 — CID 11039463
(2R,3R,4R,5S,6R)-2-[2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]prop-2-enyl]-5-methyl-4-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-ol (PubChem CID 11039463) has the molecular formula C34H68O6Si2 and a molecular weight of 629.08 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-[2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]prop-2-enyl]-5-methyl-4-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-ol.
| Compound Name | (2R,3R,4R,5S,6R)-2-[2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]prop-2-enyl]-5-methyl-4-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-ol |
|---|---|
| PubChem CID | 11039463 |
| Molecular Formula | C34H68O6Si2 |
| Molecular Weight | 629.08 g/mol |
| Exact Mass | 628.46 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]prop-2-enyl]-5-methyl-4-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-ol |
| SMILES | C=C(C[C@H]1COC(C)(C)O1)C[C@H]1O[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O |
| InChI | InChI=1S/C34H68O6Si2/c1-21(2)41(22(3)4,23(5)6)37-20-31-28(14)33(40-42(24(7)8,25(9)10)26(11)12)32(35)30(38-31)18-27(13)17-29-19-36-34(15,16)39-29/h21-26,28-33,35H,13,17-20H2,1-12,14-16H3/t28-,29-,30+,31-,32+,33+/m0/s1 |
| InChIKey | STBDLMIGBQGVEC-FVKBMIAUSA-N |
| XLogP | 8.99 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.08 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|