C24H52O4Si2 — CID 162404500
(4R,6S,7S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7,9-dimethyl-2-(trimethylsilylmethyl)dec-1-en-4-ol (PubChem CID 162404500) has the molecular formula C24H52O4Si2 and a molecular weight of 460.85 g/mol. Its IUPAC name is (4R,6S,7S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7,9-dimethyl-2-(trimethylsilylmethyl)dec-1-en-4-ol.
| Compound Name | (4R,6S,7S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7,9-dimethyl-2-(trimethylsilylmethyl)dec-1-en-4-ol |
|---|---|
| PubChem CID | 162404500 |
| Molecular Formula | C24H52O4Si2 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | (4R,6S,7S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7,9-dimethyl-2-(trimethylsilylmethyl)dec-1-en-4-ol |
| SMILES | C=C(C[C@@H](O)C[C@H](OCOC)[C@@H](C)C[C@H](C)CO[Si](C)(C)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C24H52O4Si2/c1-19(16-28-30(11,12)24(4,5)6)13-21(3)23(27-18-26-7)15-22(25)14-20(2)17-29(8,9)10/h19,21-23,25H,2,13-18H2,1,3-12H3/t19-,21-,22+,23-/m0/s1 |
| InChIKey | CWUYVQYWWSTFBW-SNJCGAMXSA-N |
| XLogP | 6.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|