C19H40O4Si — CID 10642289
(3S,6R,7R,8R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,8-dimethylnon-1-en-3-ol (PubChem CID 10642289) has the molecular formula C19H40O4Si and a molecular weight of 360.61 g/mol. Its IUPAC name is (3S,6R,7R,8R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,8-dimethylnon-1-en-3-ol.
| Compound Name | (3S,6R,7R,8R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,8-dimethylnon-1-en-3-ol |
|---|---|
| PubChem CID | 10642289 |
| Molecular Formula | C19H40O4Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (3S,6R,7R,8R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,8-dimethylnon-1-en-3-ol |
| SMILES | C=C[C@@H](O)CC[C@@H](C)[C@@H](OCOC)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O4Si/c1-10-17(20)12-11-15(2)18(22-14-21-7)16(3)13-23-24(8,9)19(4,5)6/h10,15-18,20H,1,11-14H2,2-9H3/t15-,16-,17-,18-/m1/s1 |
| InChIKey | SRHJWTSMFUCZEC-BRSBDYLESA-N |
| XLogP | 4.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|