C32H62O4Si — CID 10482385
(3R,4S,7R)-7-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methyl-4-triethylsilyloxyoctan-2-ol (PubChem CID 10482385) has the molecular formula C32H62O4Si and a molecular weight of 538.93 g/mol. Its IUPAC name is (3R,4S,7R)-7-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methyl-4-triethylsilyloxyoctan-2-ol.
| Compound Name | (3R,4S,7R)-7-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methyl-4-triethylsilyloxyoctan-2-ol |
|---|---|
| PubChem CID | 10482385 |
| Molecular Formula | C32H62O4Si |
| Molecular Weight | 538.93 g/mol |
| Exact Mass | 538.44 |
| IUPAC Name | (3R,4S,7R)-7-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methyl-4-triethylsilyloxyoctan-2-ol |
| SMILES | C=C[C@@H](C)CC[C@@H]1O[C@@]2(CC[C@H]1C)CC[C@H](C)[C@H]([C@H](C)CC[C@H](O[Si](CC)(CC)CC)[C@H](C)C(C)O)O2 |
| InChI | InChI=1S/C32H62O4Si/c1-11-23(5)15-17-29-24(6)19-21-32(34-29)22-20-26(8)31(35-32)25(7)16-18-30(27(9)28(10)33)36-37(12-2,13-3)14-4/h11,23-31,33H,1,12-22H2,2-10H3/t23-,24-,25-,26+,27-,28?,29+,30+,31+,32-/m1/s1 |
| InChIKey | QMILUTPRMPQTKL-VWXVVNTPSA-N |
| XLogP | 8.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.93 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|