C24H46O4Si — CID 134850568
tert-butyl-[2-[(4S,6S)-2,2-dimethyl-6-[[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]methyl]-1,3-dioxan-4-yl]ethoxy]-dimethylsilane (PubChem CID 134850568) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,6S)-2,2-dimethyl-6-[[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]methyl]-1,3-dioxan-4-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(4S,6S)-2,2-dimethyl-6-[[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]methyl]-1,3-dioxan-4-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134850568 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | tert-butyl-[2-[(4S,6S)-2,2-dimethyl-6-[[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]methyl]-1,3-dioxan-4-yl]ethoxy]-dimethylsilane |
| SMILES | C=CC[C@@H]1CC[C@H](C)[C@@H](C[C@@H]2C[C@H](CCO[Si](C)(C)C(C)(C)C)OC(C)(C)O2)O1 |
| InChI | InChI=1S/C24H46O4Si/c1-10-11-19-13-12-18(2)22(26-19)17-21-16-20(27-24(6,7)28-21)14-15-25-29(8,9)23(3,4)5/h10,18-22H,1,11-17H2,2-9H3/t18-,19+,20-,21-,22+/m0/s1 |
| InChIKey | WRJMQQLGISTCBP-LILSUDLASA-N |
| XLogP | 6.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|