C21H38Br2O3Si — CID 24749544
tert-butyl-[[(2R,3S,6S,8R,9S)-8-(3,3-dibromoprop-2-enyl)-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane (PubChem CID 24749544) has the molecular formula C21H38Br2O3Si and a molecular weight of 526.43 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,6S,8R,9S)-8-(3,3-dibromoprop-2-enyl)-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3S,6S,8R,9S)-8-(3,3-dibromoprop-2-enyl)-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 24749544 |
| Molecular Formula | C21H38Br2O3Si |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | tert-butyl-[[(2R,3S,6S,8R,9S)-8-(3,3-dibromoprop-2-enyl)-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane |
| SMILES | C[C@H]1CC[C@]2(CC[C@H](C)[C@@H](CC=C(Br)Br)O2)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38Br2O3Si/c1-15-10-12-21(25-17(15)8-9-19(22)23)13-11-16(2)18(26-21)14-24-27(6,7)20(3,4)5/h9,15-18H,8,10-14H2,1-7H3/t15-,16-,17+,18-,21-/m0/s1 |
| InChIKey | YWHNBTUFFLZVAE-CURYNPBISA-N |
| XLogP | 7.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|