C29H55BrO5Si2 — CID 177417479
[(1R)-3-bromo-1-[(2S,4R,6S,8S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-9-ethenyl-2-methyl-8-prop-2-enyl-1,3,7-trioxaspiro[5.5]undecan-4-yl]propoxy]-tert-butyl-dimethylsilane (PubChem CID 177417479) has the molecular formula C29H55BrO5Si2 and a molecular weight of 619.83 g/mol. Its IUPAC name is [(1R)-3-bromo-1-[(2S,4R,6S,8S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-9-ethenyl-2-methyl-8-prop-2-enyl-1,3,7-trioxaspiro[5.5]undecan-4-yl]propoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R)-3-bromo-1-[(2S,4R,6S,8S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-9-ethenyl-2-methyl-8-prop-2-enyl-1,3,7-trioxaspiro[5.5]undecan-4-yl]propoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 177417479 |
| Molecular Formula | C29H55BrO5Si2 |
| Molecular Weight | 619.83 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | [(1R)-3-bromo-1-[(2S,4R,6S,8S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-9-ethenyl-2-methyl-8-prop-2-enyl-1,3,7-trioxaspiro[5.5]undecan-4-yl]propoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@H]1O[C@@]2(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C=C)C[C@H]([C@@H](CCBr)O[Si](C)(C)C(C)(C)C)O[C@H](C)O2 |
| InChI | InChI=1S/C29H55BrO5Si2/c1-14-16-23-22(15-2)25(35-37(12,13)28(7,8)9)19-29(33-23)20-26(31-21(3)32-29)24(17-18-30)34-36(10,11)27(4,5)6/h14-15,21-26H,1-2,16-20H2,3-13H3/t21-,22-,23-,24+,25-,26+,29-/m0/s1 |
| InChIKey | WYKDROSYDLKQMM-DBGLCHLNSA-N |
| XLogP | 8.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.83 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|