C22H42O3Si — CID 10786170
tert-butyl-dimethyl-[[(2R,3S,6R,8R,10S)-3-methyl-2-propan-2-yl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]silane (PubChem CID 10786170) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R,3S,6R,8R,10S)-3-methyl-2-propan-2-yl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R,3S,6R,8R,10S)-3-methyl-2-propan-2-yl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]silane |
|---|---|
| PubChem CID | 10786170 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R,3S,6R,8R,10S)-3-methyl-2-propan-2-yl-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]silane |
| SMILES | C=CC[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@]2(CC[C@H](C)[C@@H](C(C)C)O2)O1 |
| InChI | InChI=1S/C22H42O3Si/c1-10-11-18-14-19(25-26(8,9)21(5,6)7)15-22(23-18)13-12-17(4)20(24-22)16(2)3/h10,16-20H,1,11-15H2,2-9H3/t17-,18+,19-,20+,22+/m0/s1 |
| InChIKey | LVXKPVVEFWEZBL-DNVBULBTSA-N |
| XLogP | 6.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|