C28H52O7Si — CID 71490156
tert-butyl-[(1S)-1-[(2S,4R,6S,8S,10S)-2-[(R)-methoxymethoxy-(2-methyl-1,3-dioxolan-2-yl)methyl]-4,10-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2-methylprop-2-enoxy]-dimethylsilane (PubChem CID 71490156) has the molecular formula C28H52O7Si and a molecular weight of 528.80 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2S,4R,6S,8S,10S)-2-[(R)-methoxymethoxy-(2-methyl-1,3-dioxolan-2-yl)methyl]-4,10-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2-methylprop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(2S,4R,6S,8S,10S)-2-[(R)-methoxymethoxy-(2-methyl-1,3-dioxolan-2-yl)methyl]-4,10-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2-methylprop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 71490156 |
| Molecular Formula | C28H52O7Si |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2S,4R,6S,8S,10S)-2-[(R)-methoxymethoxy-(2-methyl-1,3-dioxolan-2-yl)methyl]-4,10-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2-methylprop-2-enoxy]-dimethylsilane |
| SMILES | C=C(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H](C)C[C@]2(C[C@H](C)C[C@@H]([C@@H](OCOC)C3(C)OCCO3)O2)O1 |
| InChI | InChI=1S/C28H52O7Si/c1-19(2)24(35-36(10,11)26(5,6)7)22-14-20(3)16-28(33-22)17-21(4)15-23(34-28)25(30-18-29-9)27(8)31-12-13-32-27/h20-25H,1,12-18H2,2-11H3/t20-,21+,22-,23-,24-,25+,28-/m0/s1 |
| InChIKey | DZLIYGZWJBFZEW-RFRUWKRBSA-N |
| XLogP | 6.03 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|