C29H56O5Si2 — CID 135053802
tert-butyl-[[(4S,6R,8S,10R,13S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-10-prop-2-enyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]-dimethylsilane (PubChem CID 135053802) has the molecular formula C29H56O5Si2 and a molecular weight of 540.93 g/mol. Its IUPAC name is tert-butyl-[[(4S,6R,8S,10R,13S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-10-prop-2-enyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,6R,8S,10R,13S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-10-prop-2-enyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 135053802 |
| Molecular Formula | C29H56O5Si2 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | tert-butyl-[[(4S,6R,8S,10R,13S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-10-prop-2-enyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]-dimethylsilane |
| SMILES | C=CC[C@H]1CC[C@](C)(O[Si](C)(C)C(C)(C)C)[C@@]2(CC[C@@]3(CCC[C@@H](CO[Si](C)(C)C(C)(C)C)O3)O2)O1 |
| InChI | InChI=1S/C29H56O5Si2/c1-13-15-23-17-19-27(8,34-36(11,12)26(5,6)7)29(32-23)21-20-28(33-29)18-14-16-24(31-28)22-30-35(9,10)25(2,3)4/h13,23-24H,1,14-22H2,2-12H3/t23-,24-,27-,28+,29-/m0/s1 |
| InChIKey | MRFWZSKACBFNJU-BPMSLUIKSA-N |
| XLogP | 8.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|