C27H50O6Si — CID 134940115
tert-butyl-[(2S)-1-[(4R)-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-9-methyl-1,5,7-trioxaspiro[5.5]undecan-4-yl]hept-6-en-2-yl]oxy-dimethylsilane (PubChem CID 134940115) has the molecular formula C27H50O6Si and a molecular weight of 498.78 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-[(4R)-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-9-methyl-1,5,7-trioxaspiro[5.5]undecan-4-yl]hept-6-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-1-[(4R)-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-9-methyl-1,5,7-trioxaspiro[5.5]undecan-4-yl]hept-6-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134940115 |
| Molecular Formula | C27H50O6Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | tert-butyl-[(2S)-1-[(4R)-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-9-methyl-1,5,7-trioxaspiro[5.5]undecan-4-yl]hept-6-en-2-yl]oxy-dimethylsilane |
| SMILES | C=CCCC[C@@H](C[C@H]1CCOC2(CCC(C)C([C@H]3COC(C)(C)O3)O2)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O6Si/c1-10-11-12-13-22(33-34(8,9)25(3,4)5)18-21-15-17-28-27(30-21)16-14-20(2)24(32-27)23-19-29-26(6,7)31-23/h10,20-24H,1,11-19H2,2-9H3/t20?,21-,22+,23-,24?,27?/m1/s1 |
| InChIKey | DZIMCIFAYJYNDS-WMTGYKIXSA-N |
| XLogP | 6.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|