C23H46O5Si — CID 11407780
tert-butyl-[(2R)-2-[2-[(2S,3R,4S)-3-(methoxymethoxy)-4,6-dimethylhept-6-en-2-yl]-1,3-dioxolan-2-yl]propoxy]-dimethylsilane (PubChem CID 11407780) has the molecular formula C23H46O5Si and a molecular weight of 430.70 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[2-[(2S,3R,4S)-3-(methoxymethoxy)-4,6-dimethylhept-6-en-2-yl]-1,3-dioxolan-2-yl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[2-[(2S,3R,4S)-3-(methoxymethoxy)-4,6-dimethylhept-6-en-2-yl]-1,3-dioxolan-2-yl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11407780 |
| Molecular Formula | C23H46O5Si |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | tert-butyl-[(2R)-2-[2-[(2S,3R,4S)-3-(methoxymethoxy)-4,6-dimethylhept-6-en-2-yl]-1,3-dioxolan-2-yl]propoxy]-dimethylsilane |
| SMILES | C=C(C)C[C@H](C)[C@@H](OCOC)[C@H](C)C1([C@H](C)CO[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C23H46O5Si/c1-17(2)14-18(3)21(25-16-24-9)20(5)23(26-12-13-27-23)19(4)15-28-29(10,11)22(6,7)8/h18-21H,1,12-16H2,2-11H3/t18-,19+,20-,21+/m0/s1 |
| InChIKey | KKXZKISJBVGPLP-JSXRDJHFSA-N |
| XLogP | 5.61 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|