C22H46O4Si2 — CID 134922656
tert-butyl-[(E,2R,3R)-1-(2,6-dimethoxyoxan-4-yl)-3-methyl-5-trimethylsilylpent-4-en-2-yl]oxy-dimethylsilane (PubChem CID 134922656) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is tert-butyl-[(E,2R,3R)-1-(2,6-dimethoxyoxan-4-yl)-3-methyl-5-trimethylsilylpent-4-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,3R)-1-(2,6-dimethoxyoxan-4-yl)-3-methyl-5-trimethylsilylpent-4-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134922656 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | tert-butyl-[(E,2R,3R)-1-(2,6-dimethoxyoxan-4-yl)-3-methyl-5-trimethylsilylpent-4-en-2-yl]oxy-dimethylsilane |
| SMILES | COC1CC(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/[Si](C)(C)C)CC(OC)O1 |
| InChI | InChI=1S/C22H46O4Si2/c1-17(12-13-27(7,8)9)19(26-28(10,11)22(2,3)4)14-18-15-20(23-5)25-21(16-18)24-6/h12-13,17-21H,14-16H2,1-11H3/b13-12+/t17-,18?,19-,20?,21?/m1/s1 |
| InChIKey | WJSXVCKSRYDYAD-XNHWPWLJSA-N |
| XLogP | 6.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|