C18H38O3Si — CID 11823718
(3R,5R,6S)-6-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]-3,5-dimethyloxan-2-ol (PubChem CID 11823718) has the molecular formula C18H38O3Si and a molecular weight of 330.59 g/mol. Its IUPAC name is (3R,5R,6S)-6-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]-3,5-dimethyloxan-2-ol.
| Compound Name | (3R,5R,6S)-6-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]-3,5-dimethyloxan-2-ol |
|---|---|
| PubChem CID | 11823718 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (3R,5R,6S)-6-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]-3,5-dimethyloxan-2-ol |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H]1OC(O)[C@H](C)C[C@H]1C |
| InChI | InChI=1S/C18H38O3Si/c1-10-15(21-22(8,9)18(5,6)7)14(4)16-12(2)11-13(3)17(19)20-16/h12-17,19H,10-11H2,1-9H3/t12-,13-,14-,15+,16+,17?/m1/s1 |
| InChIKey | JQIZWHZFPOMMAW-VOYDFQSCSA-N |
| XLogP | 4.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|